cas: 215178-39-5 — see every product listed under this CAS number, including other names
(R)-1-Fmoc-3-hydroxypyrrolidine 95% (CAS 215178-39-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A845056-250mg |
| cas | 215178-39-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 748.62 Pln | |
| Ambeed | 5g | 2200.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A845056 |
9H-fluoren-9-ylmethyl (3R)-3-hydroxypyrrolidine-1-carboxylate (CAS 215178-39-5) is a chemical compound with the molecular formula C19H19NO3 and a molecular weight of 309.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl (3R)-3-hydroxypyrrolidine-1-carboxylate. InChIKey: KPDNZJQVYQCDJW-CYBMUJFWSA-N.
| Molecular formula | C19H19NO3 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl (3R)-3-hydroxypyrrolidine-1-carboxylate |
| InChIKey | KPDNZJQVYQCDJW-CYBMUJFWSA-N |
| SMILES | C1CN(C[C@@H]1O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)