CAS 1279025-92-1 is the registry number for (2R,4S)-3-Benzoyl-4-ethyl-4-methyl-2-phenyloxazolidin-5-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2R,4S)-3-benzoyl-4-ethyl-4-methyl-2-phenyl-1,3-oxazolidin-5-one (CAS 1279025-92-1) is a chemical compound with the molecular formula C19H19NO3 and a molecular weight of 309.4 g/mol. IUPAC name: (2R,4S)-3-benzoyl-4-ethyl-4-methyl-2-phenyl-1,3-oxazolidin-5-one. InChIKey: DYWWDZQRZYAPHQ-MJGOQNOKSA-N.
| Molecular formula | C19H19NO3 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | (2R,4S)-3-benzoyl-4-ethyl-4-methyl-2-phenyl-1,3-oxazolidin-5-one |
| InChIKey | DYWWDZQRZYAPHQ-MJGOQNOKSA-N |
| SMILES | CC[C@]1(C(=O)O[C@@H](N1C(=O)C2=CC=CC=C2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)