CAS 1189749-27-6 is the registry number for 2-Isopropyl-1-oxo-3-phenyl-1,2,3,4-tetrahydroisoquinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
1-oxo-3-phenyl-2-propan-2-yl-3,4-dihydroisoquinoline-4-carboxylic acid (CAS 1189749-27-6) is a chemical compound with the molecular formula C19H19NO3 and a molecular weight of 309.4 g/mol. IUPAC name: 1-oxo-3-phenyl-2-propan-2-yl-3,4-dihydroisoquinoline-4-carboxylic acid. InChIKey: FWLSZYCFYMQYSO-UHFFFAOYSA-N.
| Molecular formula | C19H19NO3 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | 1-oxo-3-phenyl-2-propan-2-yl-3,4-dihydroisoquinoline-4-carboxylic acid |
| InChIKey | FWLSZYCFYMQYSO-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(C(C2=CC=CC=C2C1=O)C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)