CAS 96930-27-7 is the registry number for (S)-4-Benzyl-3-(3-phenylpropanoyl)oxazolidin-2-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
(4S)-4-benzyl-3-(3-phenylpropanoyl)-1,3-oxazolidin-2-one (CAS 96930-27-7) is a chemical compound with the molecular formula C19H19NO3 and a molecular weight of 309.4 g/mol. IUPAC name: (4S)-4-benzyl-3-(3-phenylpropanoyl)-1,3-oxazolidin-2-one. InChIKey: CDSPCWKYSYEPMH-KRWDZBQOSA-N.
| Molecular formula | C19H19NO3 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | (4S)-4-benzyl-3-(3-phenylpropanoyl)-1,3-oxazolidin-2-one |
| InChIKey | CDSPCWKYSYEPMH-KRWDZBQOSA-N |
| SMILES | C1[C@@H](N(C(=O)O1)C(=O)CCC2=CC=CC=C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)