CAS 1375069-22-9 is the registry number for 3-Carboxymethyl-3'-(pyrrolidinocarbony)biphenyl, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-[3-[3-(pyrrolidine-1-carbonyl)phenyl]phenyl]acetic acid (CAS 1375069-22-9) is a chemical compound with the molecular formula C19H19NO3 and a molecular weight of 309.4 g/mol. IUPAC name: 2-[3-[3-(pyrrolidine-1-carbonyl)phenyl]phenyl]acetic acid. InChIKey: SGJAIVPQDHGHHV-UHFFFAOYSA-N.
| Molecular formula | C19H19NO3 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | 2-[3-[3-(pyrrolidine-1-carbonyl)phenyl]phenyl]acetic acid |
| InChIKey | SGJAIVPQDHGHHV-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)C2=CC=CC(=C2)C3=CC=CC(=C3)CC(=O)O |
Computed by PubChem (NCBI)