Products 1820647-57-1

CAS 1820647-57-1 is the registry number for methyl 2-{3-[(pyrrolidin-1-yl)carbonyl]phenyl}benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 2-[3-(pyrrolidine-1-carbonyl)phenyl]benzoate (CAS 1820647-57-1) is a chemical compound with the molecular formula C19H19NO3 and a molecular weight of 309.4 g/mol. IUPAC name: methyl 2-[3-(pyrrolidine-1-carbonyl)phenyl]benzoate. InChIKey: SFZLUYBSQAPBDP-UHFFFAOYSA-N.

Identity
Molecular formulaC19H19NO3
Molecular weight309.4 g/mol
IUPAC namemethyl 2-[3-(pyrrolidine-1-carbonyl)phenyl]benzoate
InChIKeySFZLUYBSQAPBDP-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=CC=C1C2=CC(=CC=C2)C(=O)N3CCCC3

Computed by PubChem (NCBI)