Products 1375069-18-3

CAS 1375069-18-3 is the registry number for (4-{3-[(Pyrrolidin-1-yl)carbonyl]phenyl}phenyl)acetic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

2-[4-[3-(pyrrolidine-1-carbonyl)phenyl]phenyl]acetic acid (CAS 1375069-18-3) is a chemical compound with the molecular formula C19H19NO3 and a molecular weight of 309.4 g/mol. IUPAC name: 2-[4-[3-(pyrrolidine-1-carbonyl)phenyl]phenyl]acetic acid. InChIKey: NBHYNYGABCNOFM-UHFFFAOYSA-N.

Identity
Molecular formulaC19H19NO3
Molecular weight309.4 g/mol
IUPAC name2-[4-[3-(pyrrolidine-1-carbonyl)phenyl]phenyl]acetic acid
InChIKeyNBHYNYGABCNOFM-UHFFFAOYSA-N
SMILESC1CCN(C1)C(=O)C2=CC=CC(=C2)C3=CC=C(C=C3)CC(=O)O

Computed by PubChem (NCBI)