cas: 189350-64-9 — see every product listed under this CAS number, including other names
(R)-2,2,2-Trifluoro-1-phenylethanamine hydrochloride 95+% (CAS 189350-64-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A587905-100mg |
| cas | 189350-64-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 136.75 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 464.94 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A587905 |
(1R)-2,2,2-trifluoro-1-phenylethanamine;hydrochloride (CAS 189350-64-9) is a chemical compound with the molecular formula C8H9ClF3N and a molecular weight of 211.61 g/mol. IUPAC name: (1R)-2,2,2-trifluoro-1-phenylethanamine;hydrochloride. InChIKey: LCQGOISHUDYBOS-OGFXRTJISA-N.
| Molecular formula | C8H9ClF3N |
|---|---|
| Molecular weight | 211.61 g/mol |
| IUPAC name | (1R)-2,2,2-trifluoro-1-phenylethanamine;hydrochloride |
| InChIKey | LCQGOISHUDYBOS-OGFXRTJISA-N |
| SMILES | C1=CC=C(C=C1)[C@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)