Products 1845696-01-6
CAS 1845696-01-6 is the registry number for 4-methyl-3-(trifluoromethyl)aniline hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 5g, 1g.
4-methyl-3-(trifluoromethyl)aniline;hydrochloride (CAS 1845696-01-6) is a chemical compound with the molecular formula C8H9ClF3N and a molecular weight of 211.61 g/mol. IUPAC name: 4-methyl-3-(trifluoromethyl)aniline;hydrochloride. InChIKey: HRNHAEBMBLWGAY-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3N |
|---|---|
| Molecular weight | 211.61 g/mol |
| IUPAC name | 4-methyl-3-(trifluoromethyl)aniline;hydrochloride |
| InChIKey | HRNHAEBMBLWGAY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)