CAS 128404-37-5 appears in our catalog under these names: (S)-2,2,2-Trifluoro-1-phenylethylamine hydrochloride, 95%, (S)–2,2,2–trifluoro–1–phenylethanamine hydrochloride, (S)-2,2,2-Trifluoro-1-phenylethanamine hydrochloride, 98%, 98%, (S)-2,2,2-Trifluoro-1-phenylethylaminehydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 50mg, 500mg.
(1S)-2,2,2-trifluoro-1-phenylethanamine;hydrochloride (CAS 128404-37-5) is a chemical compound with the molecular formula C8H9ClF3N and a molecular weight of 211.61 g/mol. IUPAC name: (1S)-2,2,2-trifluoro-1-phenylethanamine;hydrochloride. InChIKey: LCQGOISHUDYBOS-FJXQXJEOSA-N.
| Molecular formula | C8H9ClF3N |
|---|---|
| Molecular weight | 211.61 g/mol |
| IUPAC name | (1S)-2,2,2-trifluoro-1-phenylethanamine;hydrochloride |
| InChIKey | LCQGOISHUDYBOS-FJXQXJEOSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)