CAS 3047-99-2 appears in our catalog under these names: [4-(Trifluoromethyl)phenyl]methanamine hydrochloride, 98%, (4-(Trifluoromethyl)phenyl)methanamine hydrochloride, 98+%, Poly((9,9-dioctyl-2,7-fluorenylene)-co-(3,8-phenanthroline)) end capped with dimethylphenyl, 4–(Trifluoromethyl)benzylamine Hydrochloride, 4-(Trifluoromethyl)benzylamine Hydrochloride, >98.0%(HPLC)(N). Offered by: Combi-blocks, AmBeed, Lumtec, GLPBio, TCI. Available pack sizes: 1g, 100g, 25g, 10g, 5g, 250mg, On request, 100mg.
[4-(trifluoromethyl)phenyl]methanamine;hydrochloride (CAS 3047-99-2) is a chemical compound with the molecular formula C8H9ClF3N and a molecular weight of 211.61 g/mol. IUPAC name: [4-(trifluoromethyl)phenyl]methanamine;hydrochloride. InChIKey: DDDIOEYMKVFUGK-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3N |
|---|---|
| Molecular weight | 211.61 g/mol |
| IUPAC name | [4-(trifluoromethyl)phenyl]methanamine;hydrochloride |
| InChIKey | DDDIOEYMKVFUGK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)C(F)(F)F.Cl |
Computed by PubChem (NCBI)