CAS 189350-64-9 appears in our catalog under these names: (R)-2,2,2-Trifluoro-1-phenylethylamine hydrochloride, 95%, (R)-2,2,2-Trifluoro-1-phenylethanamine hydrochloride 95+%, (R)-2,2,2-Trifluoro-1-phenylethanamine hydrochloride, 97%, 97%, (R)-2,2,2-Trifluoro-1-phenylethylaminehydrochloride, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
(1R)-2,2,2-trifluoro-1-phenylethanamine;hydrochloride (CAS 189350-64-9) is a chemical compound with the molecular formula C8H9ClF3N and a molecular weight of 211.61 g/mol. IUPAC name: (1R)-2,2,2-trifluoro-1-phenylethanamine;hydrochloride. InChIKey: LCQGOISHUDYBOS-OGFXRTJISA-N.
| Molecular formula | C8H9ClF3N |
|---|---|
| Molecular weight | 211.61 g/mol |
| IUPAC name | (1R)-2,2,2-trifluoro-1-phenylethanamine;hydrochloride |
| InChIKey | LCQGOISHUDYBOS-OGFXRTJISA-N |
| SMILES | C1=CC=C(C=C1)[C@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)