CAS 1432679-40-7 appears in our catalog under these names: 2-(3,4,5-Trifluorophenyl)ethan-1-amine hydrochloride, 95%, 2-(3,4,5-Trifluorophenyl)ethan-1-amine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 0,5g, 50mg.
2-(3,4,5-trifluorophenyl)ethanamine;hydrochloride (CAS 1432679-40-7) is a chemical compound with the molecular formula C8H9ClF3N and a molecular weight of 211.61 g/mol. IUPAC name: 2-(3,4,5-trifluorophenyl)ethanamine;hydrochloride. InChIKey: XZZYPPHVCTXOBA-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3N |
|---|---|
| Molecular weight | 211.61 g/mol |
| IUPAC name | 2-(3,4,5-trifluorophenyl)ethanamine;hydrochloride |
| InChIKey | XZZYPPHVCTXOBA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)CCN.Cl |
Computed by PubChem (NCBI)