cas: 189350-64-9 — see every product listed under this CAS number, including other names
(R)-2,2,2-Trifluoro-1-phenylethylaminehydrochloride, 97% (CAS 189350-64-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F093856-100MG |
| cas | 189350-64-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 128.10 Pln | |
| Fluorochem | 250mg | 227.02 Pln | |
| Fluorochem | 1g | 732.05 Pln | |
| Fluorochem | 5g | 3449.84 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(1R)-2,2,2-trifluoro-1-phenylethanamine;hydrochloride (CAS 189350-64-9) is a chemical compound with the molecular formula C8H9ClF3N and a molecular weight of 211.61 g/mol. IUPAC name: (1R)-2,2,2-trifluoro-1-phenylethanamine;hydrochloride. InChIKey: LCQGOISHUDYBOS-OGFXRTJISA-N.
| Molecular formula | C8H9ClF3N |
|---|---|
| Molecular weight | 211.61 g/mol |
| IUPAC name | (1R)-2,2,2-trifluoro-1-phenylethanamine;hydrochloride |
| InChIKey | LCQGOISHUDYBOS-OGFXRTJISA-N |
| SMILES | C1=CC=C(C=C1)[C@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)