CAS 1218935-60-4 appears in our catalog under these names: (R)–2–(2,5–Difluorophenyl)pyrrolidine hydrochloride, (R)-2-(2,5-Difluorophenyl)pyrrolidine hydrochloride, (R)-2-(2,5-Difluorophenyl)pyrrolidine hydrochloride, 95%, 95%, (R)-2-(2,5-Difluorophenyl)pyrrolidine hydrochloride, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 25g, 100mg.
(2R)-2-(2,5-difluorophenyl)pyrrolidine;hydrochloride (CAS 1218935-60-4) is a chemical compound with the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. IUPAC name: (2R)-2-(2,5-difluorophenyl)pyrrolidine;hydrochloride. InChIKey: XSWCQOVADZHFIJ-HNCPQSOCSA-N.
| Molecular formula | C10H12ClF2N |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | (2R)-2-(2,5-difluorophenyl)pyrrolidine;hydrochloride |
| InChIKey | XSWCQOVADZHFIJ-HNCPQSOCSA-N |
| SMILES | C1C[C@@H](NC1)C2=C(C=CC(=C2)F)F.Cl |
Computed by PubChem (NCBI)