Products 1820570-11-3
CAS 1820570-11-3 appears in our catalog under these names: (1R)-5,7-difluoro-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 95%, (1R)-5,7-Difluoro-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
(1R)-5,7-difluoro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 1820570-11-3) is a chemical compound with the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. IUPAC name: (1R)-5,7-difluoro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: ADAKOZOQLXJQTC-HNCPQSOCSA-N.
| Molecular formula | C10H12ClF2N |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | (1R)-5,7-difluoro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | ADAKOZOQLXJQTC-HNCPQSOCSA-N |
| SMILES | C1C[C@H](C2=C(C1)C(=CC(=C2)F)F)N.Cl |
Computed by PubChem (NCBI)