Products 2135331-85-8
CAS 2135331-85-8 appears in our catalog under these names: 2-(2,6-Difluorophenyl)pyrrolidine hydrochloride, 95%, 2-(2,6-Difluorophenyl)pyrrolidine hydrochloride 95+%, 2-(2,6-Difluorophenyl)pyrrolidine hydrochloride, 95+%, 95+%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
2-(2,6-difluorophenyl)pyrrolidine;hydrochloride (CAS 2135331-85-8) is a chemical compound with the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. IUPAC name: 2-(2,6-difluorophenyl)pyrrolidine;hydrochloride. InChIKey: IYHWYBGGVJBQCG-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF2N |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | 2-(2,6-difluorophenyl)pyrrolidine;hydrochloride |
| InChIKey | IYHWYBGGVJBQCG-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=C(C=CC=C2F)F.Cl |
Computed by PubChem (NCBI)