Products 2416233-91-3
CAS 2416233-91-3 is the registry number for N-[(3,5-Difluorophenyl)methyl]cyclopropanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
N-[(3,5-difluorophenyl)methyl]cyclopropanamine;hydrochloride (CAS 2416233-91-3) is a chemical compound with the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. IUPAC name: N-[(3,5-difluorophenyl)methyl]cyclopropanamine;hydrochloride. InChIKey: ZGUXJGSSOGIJTO-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF2N |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | N-[(3,5-difluorophenyl)methyl]cyclopropanamine;hydrochloride |
| InChIKey | ZGUXJGSSOGIJTO-UHFFFAOYSA-N |
| SMILES | C1CC1NCC2=CC(=CC(=C2)F)F.Cl |
Computed by PubChem (NCBI)