Products 2250242-36-3
CAS 2250242-36-3 appears in our catalog under these names: (S)-2-(3,5-Difluorophenyl)pyrrolidine hydrochloride, 95%, (S)–2–(3，5–Difluorophenyl)pyrrolidine hydrochloride, (S)-2-(3,5-Difluorophenyl)pyrrolidine hydrochloride. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 100mg, 1g, 2,5g.
(2S)-2-(3,5-difluorophenyl)pyrrolidine;hydrochloride (CAS 2250242-36-3) is a chemical compound with the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. IUPAC name: (2S)-2-(3,5-difluorophenyl)pyrrolidine;hydrochloride. InChIKey: TYNQBQBSZWTLJM-PPHPATTJSA-N.
| Molecular formula | C10H12ClF2N |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | (2S)-2-(3,5-difluorophenyl)pyrrolidine;hydrochloride |
| InChIKey | TYNQBQBSZWTLJM-PPHPATTJSA-N |
| SMILES | C1C[C@H](NC1)C2=CC(=CC(=C2)F)F.Cl |
Computed by PubChem (NCBI)