CAS 1199783-14-6 is the registry number for 5,7-Difluoro-1,2,3,4-tetrahydro-naphthalen-1-ylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
5,7-difluoro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 1199783-14-6) is a chemical compound with the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. IUPAC name: 5,7-difluoro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: ADAKOZOQLXJQTC-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF2N |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | 5,7-difluoro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | ADAKOZOQLXJQTC-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C(=CC(=C2)F)F)N.Cl |
Computed by PubChem (NCBI)