CAS 1443538-50-8 appears in our catalog under these names: (R)-2-(3,5-Difluorophenyl)pyrrolidine hydrochloride, 95%, (R)-2-(3,5-Difluorophenyl)pyrrolidine hydrochloride, 97%, (R)–2–(3,5–Difluorophenyl)pyrrolidine hydrochloride, (R)-2-(3,5-Difluorophenyl)pyrrolidine hydrochloride, 95%, 95%, (R)-2-(3,5-DIFLUOROPHENYL)PYRROLIDINE HCL, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(2R)-2-(3,5-difluorophenyl)pyrrolidine;hydrochloride (CAS 1443538-50-8) is a chemical compound with the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. IUPAC name: (2R)-2-(3,5-difluorophenyl)pyrrolidine;hydrochloride. InChIKey: TYNQBQBSZWTLJM-HNCPQSOCSA-N.
| Molecular formula | C10H12ClF2N |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | (2R)-2-(3,5-difluorophenyl)pyrrolidine;hydrochloride |
| InChIKey | TYNQBQBSZWTLJM-HNCPQSOCSA-N |
| SMILES | C1C[C@@H](NC1)C2=CC(=CC(=C2)F)F.Cl |
Computed by PubChem (NCBI)