(R)-2-Amino-2-(3-(methylthio)phenyl)ethanol hydrochloride, 95%
cas: 2442565-24-2 — see every product listed under this CAS number, including other names
(R)-2-Amino-2-(3-(methylthio)phenyl)ethanol hydrochloride, 95% (CAS 2442565-24-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1192419-250mg |
| cas | 2442565-24-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1838.88 Pln | |
| Ambeed | 1g | 4397.62 Pln | |
| Chemat | 100mg | 1533.20 Pln | |
| Chemat | 250mg | 2267.60 Pln | |
| Chemat | 1g | 5570.00 Pln | |
| Fluorochem | 1g | 10150.61 Pln | |
| BLDpharm | 100mg | 1325.11 Pln | |
| BLDpharm | 250mg | 1974.88 Pln | |
| BLDpharm | 1g | 4735.02 Pln | |
| Fluorochem | 100mg | 2856.30 Pln | |
| Fluorochem | 250mg | 4194.37 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(2R)-2-amino-2-(3-methylsulfanylphenyl)ethanol;hydrochloride (CAS 2442565-24-2) is a chemical compound with the molecular formula C9H14ClNOS and a molecular weight of 219.73 g/mol. IUPAC name: (2R)-2-amino-2-(3-methylsulfanylphenyl)ethanol;hydrochloride. InChIKey: FAKQQESIYANEIA-FVGYRXGTSA-N.
| Molecular formula | C9H14ClNOS |
|---|---|
| Molecular weight | 219.73 g/mol |
| IUPAC name | (2R)-2-amino-2-(3-methylsulfanylphenyl)ethanol;hydrochloride |
| InChIKey | FAKQQESIYANEIA-FVGYRXGTSA-N |
| SMILES | CSC1=CC=CC(=C1)[C@H](CO)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(R)-2-Amino-2-(3-(methylthio)phenyl)ethanol hydrochloride, (R)-2-Amino-2-(3-(methylthio)phenyl)ethanolhydrochloride, (2R)-2-amino-2-(3-methylsulfanylphenyl)ethanol;hydrochloride, (2R)-2-Amino-2-(3-methylthiophenyl)ethan-1-ol hydrochloride, (2R)-2-Amino-2-(3-methylthiophenyl)ethan-1-ol HCl, (R)-2-Amino-2-(3-(methylthio)phenyl)ethanol HCl