CAS 1807940-90-4 is the registry number for rac-((3R,4S)-4-(Thiophen-3-yl)pyrrolidin-3-yl)methanol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[(3S,4R)-4-thiophen-3-ylpyrrolidin-3-yl]methanol;hydrochloride (CAS 1807940-90-4) is a chemical compound with the molecular formula C9H14ClNOS and a molecular weight of 219.73 g/mol. IUPAC name: [(3S,4R)-4-thiophen-3-ylpyrrolidin-3-yl]methanol;hydrochloride. InChIKey: UQLVKSZJIMTXGK-OZZZDHQUSA-N.
| Molecular formula | C9H14ClNOS |
|---|---|
| Molecular weight | 219.73 g/mol |
| IUPAC name | [(3S,4R)-4-thiophen-3-ylpyrrolidin-3-yl]methanol;hydrochloride |
| InChIKey | UQLVKSZJIMTXGK-OZZZDHQUSA-N |
| SMILES | C1[C@H]([C@@H](CN1)C2=CSC=C2)CO.Cl |
Computed by PubChem (NCBI)