CAS 1310421-49-8 is the registry number for {4-Methyl-4H,6H,7H-thieno(3,2-c)pyran-4-yl}methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(4-methyl-6,7-dihydrothieno[3,2-c]pyran-4-yl)methanamine;hydrochloride (CAS 1310421-49-8) is a chemical compound with the molecular formula C9H14ClNOS and a molecular weight of 219.73 g/mol. IUPAC name: (4-methyl-6,7-dihydrothieno[3,2-c]pyran-4-yl)methanamine;hydrochloride. InChIKey: DHKAOLLAKIKBAF-UHFFFAOYSA-N.
| Molecular formula | C9H14ClNOS |
|---|---|
| Molecular weight | 219.73 g/mol |
| IUPAC name | (4-methyl-6,7-dihydrothieno[3,2-c]pyran-4-yl)methanamine;hydrochloride |
| InChIKey | DHKAOLLAKIKBAF-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(CCO1)SC=C2)CN.Cl |
Computed by PubChem (NCBI)