Products 1909294-99-0
CAS 1909294-99-0 is the registry number for rac-(2R,4R)-2-(Thiophen-2-yl)oxan-4-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,25g, 25mg.
(2R,4R)-2-thiophen-2-yloxan-4-amine;hydrochloride (CAS 1909294-99-0) is a chemical compound with the molecular formula C9H14ClNOS and a molecular weight of 219.73 g/mol. IUPAC name: (2R,4R)-2-thiophen-2-yloxan-4-amine;hydrochloride. InChIKey: PYOGIEWQYLQFTP-SCLLHFNJSA-N.
| Molecular formula | C9H14ClNOS |
|---|---|
| Molecular weight | 219.73 g/mol |
| IUPAC name | (2R,4R)-2-thiophen-2-yloxan-4-amine;hydrochloride |
| InChIKey | PYOGIEWQYLQFTP-SCLLHFNJSA-N |
| SMILES | C1CO[C@H](C[C@@H]1N)C2=CC=CS2.Cl |
Computed by PubChem (NCBI)