cas: 511272-50-7 — see every product listed under this CAS number, including other names
(R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(2-fluorophenyl)propanoic acid, 95% (CAS 511272-50-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F619832-100MG |
| cas | 511272-50-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 810.15 Pln | |
| Fluorochem | 5g | 2611.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-fluorophenyl)propanoic acid (CAS 511272-50-7) is a chemical compound with the molecular formula C24H20FNO4 and a molecular weight of 405.4 g/mol. IUPAC name: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-fluorophenyl)propanoic acid. InChIKey: LYKQNUSJPNQQLZ-JOCHJYFZSA-N.
| Molecular formula | C24H20FNO4 |
|---|---|
| Molecular weight | 405.4 g/mol |
| IUPAC name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-fluorophenyl)propanoic acid |
| InChIKey | LYKQNUSJPNQQLZ-JOCHJYFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC(=O)O)C4=CC=CC=C4F |
Computed by PubChem (NCBI)