cas: 500788-89-6 — see every product listed under this CAS number, including other names
(R)-3-((tert-Butoxycarbonyl)amino)-3-(3-hydroxyphenyl)propanoic acid, 96% (CAS 500788-89-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F448285-100MG |
| cas | 500788-89-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 247.85 Pln | |
| Fluorochem | 250mg | 409.25 Pln | |
| Fluorochem | 1g | 1039.24 Pln | |
| Fluorochem | 5g | 4246.44 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
(3R)-3-(3-hydroxyphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 500788-89-6) is a chemical compound with the molecular formula C14H19NO5 and a molecular weight of 281.30 g/mol. IUPAC name: (3R)-3-(3-hydroxyphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: KLIMLFKCLBBZKH-LLVKDONJSA-N.
| Molecular formula | C14H19NO5 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | (3R)-3-(3-hydroxyphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | KLIMLFKCLBBZKH-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)O)C1=CC(=CC=C1)O |
Computed by PubChem (NCBI)