cas: 501120-99-6 — see every product listed under this CAS number, including other names
(R)-3-(P-NITROPHENYL)-BETA-ALANINE, 97%, 97% (CAS 501120-99-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9YH-250mg |
| cas | 501120-99-6 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 1005.20 Pln | |
| Chemat | 25g | 3275.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3R)-3-amino-3-(4-nitrophenyl)propanoic acid (CAS 501120-99-6) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: (3R)-3-amino-3-(4-nitrophenyl)propanoic acid. InChIKey: JVQPVKJZKRICRR-MRVPVSSYSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | (3R)-3-amino-3-(4-nitrophenyl)propanoic acid |
| InChIKey | JVQPVKJZKRICRR-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](CC(=O)O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)