(R)-3-Amino-2-benzylpropanoic acid hydrochloride, 95%, 95%
cas: 1276055-51-6 — see every product listed under this CAS number, including other names
(R)-3-Amino-2-benzylpropanoic acid hydrochloride, 95%, 95% (CAS 1276055-51-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111X80-100mg |
| cas | 1276055-51-6 |
| size | 100mg |
| availability | 2g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 520.40 Pln | |
| Chemat | 250mg | 981.20 Pln | |
| Chemat | 1g | 1869.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-(aminomethyl)-3-phenylpropanoic acid;hydrochloride (CAS 1276055-51-6) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: (2R)-2-(aminomethyl)-3-phenylpropanoic acid;hydrochloride. InChIKey: HIYMCIGQCWOWJV-SBSPUUFOSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | (2R)-2-(aminomethyl)-3-phenylpropanoic acid;hydrochloride |
| InChIKey | HIYMCIGQCWOWJV-SBSPUUFOSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](CN)C(=O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
(R)-3-Amino-2-benzylpropanoic acid hydrochloride, (R)-3-amino-2-benzylpropanoic acid-HCl, (r)-3-amino-2-benzylpropanoic acid hcl, (2R)-2-(aminomethyl)-3-phenylpropanoic acid;hydrochloride, (R)-3-Amino-2-benzylpropanoicacidhydrochloride, (2R)-2-(aminomethyl)-3-phenyl-propanoic acid;hydrochloride, (R)-beta2-homophenylalanine HCl salt, (2R)-2-(Aminomethyl)-3-phenylpropanoic acid--hydrogen chloride (1/1)