CAS 34404-37-0 appears in our catalog under these names: Benzyl (2r)-2-aminopropanoate hydrochloride, 95%, Benzyl (2R)-2-aopropanoate hydrochloride, H-D-Ala-OBzl HCl 95%, D-Alanine, phenylmethyl ester, hydrochloride (1:1), 98%, 98%, Benzyl (2r)-2-aminopropanoate hydrochloride, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 2,5g, 0,25g, 25g, 100g, 100mg.
Benzyl (2R)-2-aminopropanoate;hydrochloride (CAS 34404-37-0) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: benzyl (2R)-2-aminopropanoate;hydrochloride. InChIKey: RLMHWGDKMJIEHH-DDWIOCJRSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | benzyl (2R)-2-aminopropanoate;hydrochloride |
| InChIKey | RLMHWGDKMJIEHH-DDWIOCJRSA-N |
| SMILES | C[C@H](C(=O)OCC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)