cas: 744193-65-5 — see every product listed under this CAS number, including other names
(R)-3-Amino-3-(3,5-dimethoxyphenyl)propanoic acid, 95%, 95% (CAS 744193-65-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116BNW-100mg |
| cas | 744193-65-5 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 630.80 Pln | |
| Chemat | 250mg | 909.20 Pln | |
| Chemat | 1g | 1758.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3R)-3-amino-3-(3,5-dimethoxyphenyl)propanoic acid (CAS 744193-65-5) is a chemical compound with the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. IUPAC name: (3R)-3-amino-3-(3,5-dimethoxyphenyl)propanoic acid. InChIKey: HUPNLRFWWQFWCS-SNVBAGLBSA-N.
| Molecular formula | C11H15NO4 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | (3R)-3-amino-3-(3,5-dimethoxyphenyl)propanoic acid |
| InChIKey | HUPNLRFWWQFWCS-SNVBAGLBSA-N |
| SMILES | COC1=CC(=CC(=C1)[C@@H](CC(=O)O)N)OC |
Computed by PubChem (NCBI)