CAS 696641-73-3 appears in our catalog under these names: (S)-3-Amino-3-(3,4-dimethoxyphenyl)propanoic acid, 95%, (S)-3-Amino-3-(3,4-dimethoxy-phenyl)-propionic acid, 97%, (S)-3-Amino-3-(3,4-dimethoxyphenyl)propanoic acid, 95%, 95%, H-β-Phe(3,4-DiOMe)-OH 97%, DL-ß-(3,4-Dimethoxyphenyl)alanine, 98%. Offered by: Fluorochem, Combi-blocks, Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g, 100g.
(3S)-3-amino-3-(3,4-dimethoxyphenyl)propanoic acid (CAS 696641-73-3) is a chemical compound with the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. IUPAC name: (3S)-3-amino-3-(3,4-dimethoxyphenyl)propanoic acid. InChIKey: FGCXSFRGPCUBPW-QMMMGPOBSA-N.
| Molecular formula | C11H15NO4 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | (3S)-3-amino-3-(3,4-dimethoxyphenyl)propanoic acid |
| InChIKey | FGCXSFRGPCUBPW-QMMMGPOBSA-N |
| SMILES | COC1=C(C=C(C=C1)[C@H](CC(=O)O)N)OC |
Computed by PubChem (NCBI)