CAS 744193-65-5 appears in our catalog under these names: (R)-3-Amino-3-(3,5-dimethoxy-phenyl)-propionic acid, 95%, (R)-3-Amino-3-(3,5-dimethoxyphenyl)propanoic acid, 95%, 95%, (R)-3-Amino-3-(3,5-dimethoxyphenyl)propanoic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
(3R)-3-amino-3-(3,5-dimethoxyphenyl)propanoic acid (CAS 744193-65-5) is a chemical compound with the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. IUPAC name: (3R)-3-amino-3-(3,5-dimethoxyphenyl)propanoic acid. InChIKey: HUPNLRFWWQFWCS-SNVBAGLBSA-N.
| Molecular formula | C11H15NO4 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | (3R)-3-amino-3-(3,5-dimethoxyphenyl)propanoic acid |
| InChIKey | HUPNLRFWWQFWCS-SNVBAGLBSA-N |
| SMILES | COC1=CC(=CC(=C1)[C@@H](CC(=O)O)N)OC |
Computed by PubChem (NCBI)