(R)-4-(1-Amino-2,2,2-trifluoroethyl)aniline, 97%
cas: 1213382-95-6 — see every product listed under this CAS number, including other names
(R)-4-(1-Amino-2,2,2-trifluoroethyl)aniline, 97% (CAS 1213382-95-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A744023-50mg |
| cas | 1213382-95-6 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 476.06 Pln | |
| Ambeed | 100mg | 770.88 Pln | |
| Ambeed | 250mg | 1327.12 Pln | |
| Ambeed | 1g | 3468.69 Pln | |
| BLDpharm | 50mg | 508.73 Pln | |
| BLDpharm | 100mg | 825.29 Pln | |
| BLDpharm | 250mg | 1430.63 Pln | |
| BLDpharm | 1g | 3735.38 Pln | |
| Chemat | 50mg | 549.20 Pln | |
| Chemat | 100mg | 890.00 Pln | |
| Chemat | 250mg | 1557.20 Pln | |
| Chemat | 1g | 4538.00 Pln | |
| Fluorochem | 250mg | 2897.96 Pln | |
| Fluorochem | 1g | 8265.86 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
4-[(1R)-1-amino-2,2,2-trifluoroethyl]aniline (CAS 1213382-95-6) is a chemical compound with the molecular formula C8H9F3N2 and a molecular weight of 190.17 g/mol. IUPAC name: 4-[(1R)-1-amino-2,2,2-trifluoroethyl]aniline. InChIKey: OBHDPXUAHBSVPI-SSDOTTSWSA-N.
| Molecular formula | C8H9F3N2 |
|---|---|
| Molecular weight | 190.17 g/mol |
| IUPAC name | 4-[(1R)-1-amino-2,2,2-trifluoroethyl]aniline |
| InChIKey | OBHDPXUAHBSVPI-SSDOTTSWSA-N |
| SMILES | C1=CC(=CC=C1[C@H](C(F)(F)F)N)N |
Computed by PubChem (NCBI)