Products 1213382-95-6
CAS 1213382-95-6 appears in our catalog under these names: (R)-4-(1-Amino-2,2,2-trifluoroethyl)aniline, 97%, 97%, (R)-4-(1-Amino-2,2,2-trifluoroethyl)aniline, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 1g, 100mg, 250mg.
4-[(1R)-1-amino-2,2,2-trifluoroethyl]aniline (CAS 1213382-95-6) is a chemical compound with the molecular formula C8H9F3N2 and a molecular weight of 190.17 g/mol. IUPAC name: 4-[(1R)-1-amino-2,2,2-trifluoroethyl]aniline. InChIKey: OBHDPXUAHBSVPI-SSDOTTSWSA-N.
| Molecular formula | C8H9F3N2 |
|---|---|
| Molecular weight | 190.17 g/mol |
| IUPAC name | 4-[(1R)-1-amino-2,2,2-trifluoroethyl]aniline |
| InChIKey | OBHDPXUAHBSVPI-SSDOTTSWSA-N |
| SMILES | C1=CC(=CC=C1[C@H](C(F)(F)F)N)N |
Computed by PubChem (NCBI)