cas: 17654-19-2 — see every product listed under this CAS number, including other names
(R)-5,7-Dihydroxy-2-(4-hydroxyphenyl)chroman-4-one 98% 99%ee (CAS 17654-19-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1167947-50mg |
| cas | 17654-19-2 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 592.88 Pln | |
| Ambeed | 100mg | 898.81 Pln | |
| Ambeed | 250mg | 1744.31 Pln | |
| Ambeed | 1g | 4286.38 Pln | |
| Ambeed | 5g | 12758.06 Pln |
| purity | 98% 99%ee |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1167947 |
(R)-naringenin is the (R)-enantiomer of naringenin. It is an enantiomer of a (S)-naringenin.
Source: ChEBI
| Molecular formula | C15H12O5 |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | (2R)-5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| InChIKey | FTVWIRXFELQLPI-CYBMUJFWSA-N |
| SMILES | C1[C@@H](OC2=CC(=CC(=C2C1=O)O)O)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)