CAS 143091-87-6 appears in our catalog under these names: Omega-benzoyloxy resacetophenone, 95%, ω-Benzoyloxy resacetophenone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100g, 25g, 5g, 50g.
[2-(2,4-dihydroxyphenyl)-2-oxoethyl] benzoate (CAS 143091-87-6) is a chemical compound with the molecular formula C15H12O5 and a molecular weight of 272.25 g/mol. IUPAC name: [2-(2,4-dihydroxyphenyl)-2-oxoethyl] benzoate. InChIKey: PNHSYFGFULSUDP-UHFFFAOYSA-N.
| Molecular formula | C15H12O5 |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | [2-(2,4-dihydroxyphenyl)-2-oxoethyl] benzoate |
| InChIKey | PNHSYFGFULSUDP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OCC(=O)C2=C(C=C(C=C2)O)O |
Computed by PubChem (NCBI)