CAS 4756-45-0 appears in our catalog under these names: 2'-Carboxy-2-hydroxy-4-methoxybenzo-phenone, 95%, 2-(2-Hydroxy-4-methoxybenzoyl)benzoic acid, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 5g, on request.
2-(2-hydroxy-4-methoxybenzoyl)benzoic acid (CAS 4756-45-0) is a chemical compound with the molecular formula C15H12O5 and a molecular weight of 272.25 g/mol. IUPAC name: 2-(2-hydroxy-4-methoxybenzoyl)benzoic acid. InChIKey: JLZIIHMTTRXXIN-UHFFFAOYSA-N.
| Molecular formula | C15H12O5 |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | 2-(2-hydroxy-4-methoxybenzoyl)benzoic acid |
| InChIKey | JLZIIHMTTRXXIN-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)C2=CC=CC=C2C(=O)O)O |
Computed by PubChem (NCBI)