Products 17175-12-1

CAS 17175-12-1 is the registry number for Methyl 4-[(phenoxycarbonyl)oxy]benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

Methyl 4-phenoxycarbonyloxybenzoate (CAS 17175-12-1) is a chemical compound with the molecular formula C15H12O5 and a molecular weight of 272.25 g/mol. IUPAC name: methyl 4-phenoxycarbonyloxybenzoate. InChIKey: OFTCZSGUKMVSON-UHFFFAOYSA-N.

Identity
Molecular formulaC15H12O5
Molecular weight272.25 g/mol
IUPAC namemethyl 4-phenoxycarbonyloxybenzoate
InChIKeyOFTCZSGUKMVSON-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(C=C1)OC(=O)OC2=CC=CC=C2

Computed by PubChem (NCBI)