Products 1820684-07-8
CAS 1820684-07-8 is the registry number for methyl 3-(2H-1,3-benzodioxol-5-yl)-5-hydroxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 3-(1,3-benzodioxol-5-yl)-5-hydroxybenzoate (CAS 1820684-07-8) is a chemical compound with the molecular formula C15H12O5 and a molecular weight of 272.25 g/mol. IUPAC name: methyl 3-(1,3-benzodioxol-5-yl)-5-hydroxybenzoate. InChIKey: IAMSTNAQLCYGDV-UHFFFAOYSA-N.
| Molecular formula | C15H12O5 |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | methyl 3-(1,3-benzodioxol-5-yl)-5-hydroxybenzoate |
| InChIKey | IAMSTNAQLCYGDV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C2=CC3=C(C=C2)OCO3)O |
Computed by PubChem (NCBI)