CAS 664366-03-4 is the registry number for (3,5-Dimethyl-7-oxo-7h-furo[3,2-g]chromen-6-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetic acid (CAS 664366-03-4) is a chemical compound with the molecular formula C15H12O5 and a molecular weight of 272.25 g/mol. IUPAC name: 2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetic acid. InChIKey: GZTDMFIUPUXXTH-UHFFFAOYSA-N.
| Molecular formula | C15H12O5 |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | 2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetic acid |
| InChIKey | GZTDMFIUPUXXTH-UHFFFAOYSA-N |
| SMILES | CC1=COC2=CC3=C(C=C12)C(=C(C(=O)O3)CC(=O)O)C |
Computed by PubChem (NCBI)