Products 664366-03-4

CAS 664366-03-4 is the registry number for (3,5-Dimethyl-7-oxo-7h-furo[3,2-g]chromen-6-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetic acid (CAS 664366-03-4) is a chemical compound with the molecular formula C15H12O5 and a molecular weight of 272.25 g/mol. IUPAC name: 2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetic acid. InChIKey: GZTDMFIUPUXXTH-UHFFFAOYSA-N.

Identity
Molecular formulaC15H12O5
Molecular weight272.25 g/mol
IUPAC name2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetic acid
InChIKeyGZTDMFIUPUXXTH-UHFFFAOYSA-N
SMILESCC1=COC2=CC3=C(C=C12)C(=C(C(=O)O3)CC(=O)O)C

Computed by PubChem (NCBI)