CAS 935395-99-6 is the registry number for 2-Methoxy-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-carboxyphenyl)-3-methoxybenzoic acid (CAS 935395-99-6) is a chemical compound with the molecular formula C15H12O5 and a molecular weight of 272.25 g/mol. IUPAC name: 4-(4-carboxyphenyl)-3-methoxybenzoic acid. InChIKey: DDAUYYAKJWTMGF-UHFFFAOYSA-N.
| Molecular formula | C15H12O5 |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | 4-(4-carboxyphenyl)-3-methoxybenzoic acid |
| InChIKey | DDAUYYAKJWTMGF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)