CAS 331763-77-0 is the registry number for (S)–3–Amino–4–(4–nitrophenyl)butanoic acid hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
(3S)-3-amino-4-(4-nitrophenyl)butanoic acid;hydrochloride (CAS 331763-77-0) is a chemical compound with the molecular formula C10H13ClN2O4 and a molecular weight of 260.67 g/mol. IUPAC name: (3S)-3-amino-4-(4-nitrophenyl)butanoic acid;hydrochloride. InChIKey: WPIIXVVGUXXORP-QRPNPIFTSA-N.
| Molecular formula | C10H13ClN2O4 |
|---|---|
| Molecular weight | 260.67 g/mol |
| IUPAC name | (3S)-3-amino-4-(4-nitrophenyl)butanoic acid;hydrochloride |
| InChIKey | WPIIXVVGUXXORP-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](CC(=O)O)N)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)