CAS 1258651-86-3 appears in our catalog under these names: 2-((3-Oxopiperazin-1-yl)methyl)furan-3-carboxylic acid hydrochloride, 2-((3-Oxopiperazin-1-yl)methyl)furan-3-carboxylic acid hydrochloride, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
2-[(3-oxopiperazin-1-yl)methyl]furan-3-carboxylic acid;hydrochloride (CAS 1258651-86-3) is a chemical compound with the molecular formula C10H13ClN2O4 and a molecular weight of 260.67 g/mol. IUPAC name: 2-[(3-oxopiperazin-1-yl)methyl]furan-3-carboxylic acid;hydrochloride. InChIKey: PKODAZYIWPNGTR-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O4 |
|---|---|
| Molecular weight | 260.67 g/mol |
| IUPAC name | 2-[(3-oxopiperazin-1-yl)methyl]furan-3-carboxylic acid;hydrochloride |
| InChIKey | PKODAZYIWPNGTR-UHFFFAOYSA-N |
| SMILES | C1CN(CC(=O)N1)CC2=C(C=CO2)C(=O)O.Cl |
Computed by PubChem (NCBI)