(R)-Methyl 4-(1-aminoethyl)benzoate hydrochloride, 95%
cas: 1097196-96-7 — see every product listed under this CAS number, including other names
(R)-Methyl 4-(1-aminoethyl)benzoate hydrochloride, 95% (CAS 1097196-96-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A674391-250mg |
| cas | 1097196-96-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 392.62 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 371.60 Pln | |
| BLDpharm | 100mg | 203.29 Pln | |
| BLDpharm | 250mg | 231.05 Pln | |
| BLDpharm | 1g | 419.88 Pln | |
| Fluorochem | 100mg | 206.20 Pln | |
| Fluorochem | 250mg | 325.94 Pln | |
| Fluorochem | 1g | 674.78 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 4-[(1R)-1-aminoethyl]benzoate;hydrochloride (CAS 1097196-96-7) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: methyl 4-[(1R)-1-aminoethyl]benzoate;hydrochloride. InChIKey: XOTRLVYRAWIVLC-OGFXRTJISA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | methyl 4-[(1R)-1-aminoethyl]benzoate;hydrochloride |
| InChIKey | XOTRLVYRAWIVLC-OGFXRTJISA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)C(=O)OC)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
methyl 4-((1R)-1-aminoethyl)benzoate hydrochloride, (R)-4-(1-Amino-ethyl)-benzoic acid methyl ester hydrochloride, (R)-Methyl 4-(1-aminoethyl)benzoate hydrochloride, methyl (R)-4-(1-aminoethyl)benzoate hydrochloride, methyl 4-[(1R)-1-aminoethyl]benzoate;hydrochloride, methyl (R)-4-(1-aminoethyl)b, (R)-Methyl4-(1-aminoethyl)benzoatehydrochloride