Products 1097196-96-7
CAS 1097196-96-7 appears in our catalog under these names: (R)-4-(1-Amino-ethyl)-benzoic acid methyl ester hydrochloride, 96%, (R)-4-(1-Amino-ethyl)-benzoic acid methyl ester hydrochloride, (R)-Methyl 4-(1-aminoethyl)benzoate hydrochloride 95%, (R)-Methyl 4-(1-aminoethyl)benzoate hydrochloride, 95%, 95%, (R)-Methyl 4-(1-aminoethyl)benzoate hydrochloride, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg.
Methyl 4-[(1R)-1-aminoethyl]benzoate;hydrochloride (CAS 1097196-96-7) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: methyl 4-[(1R)-1-aminoethyl]benzoate;hydrochloride. InChIKey: XOTRLVYRAWIVLC-OGFXRTJISA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | methyl 4-[(1R)-1-aminoethyl]benzoate;hydrochloride |
| InChIKey | XOTRLVYRAWIVLC-OGFXRTJISA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)C(=O)OC)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
methyl 4-((1R)-1-aminoethyl)benzoate hydrochloride, (R)-4-(1-Amino-ethyl)-benzoic acid methyl ester hydrochloride, (R)-Methyl 4-(1-aminoethyl)benzoate hydrochloride, methyl (R)-4-(1-aminoethyl)benzoate hydrochloride, methyl 4-[(1R)-1-aminoethyl]benzoate;hydrochloride, methyl (R)-4-(1-aminoethyl)b, (R)-Methyl4-(1-aminoethyl)benzoatehydrochloride