cas: 454248-53-4 — see every product listed under this CAS number, including other names
(R)-tert-Butyl 4-methyl-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 98%, 98% (CAS 454248-53-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DLF5-250mg |
| cas | 454248-53-4 |
| size | 250mg |
| availability | 768.5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 141.20 Pln | |
| Chemat | 10g | 222.80 Pln | |
| Chemat | 25g | 371.60 Pln | |
| Chemat | 50g | 611.60 Pln | |
| Chemat | 100g | 1029.20 Pln | |
| Chemat | 250g | 1922.00 Pln | |
| Chemat | 500g | 3441.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (4R)-4-methyl-2,2-dioxooxathiazolidine-3-carboxylate (CAS 454248-53-4) is a chemical compound with the molecular formula C8H15NO5S and a molecular weight of 237.28 g/mol. IUPAC name: tert-butyl (4R)-4-methyl-2,2-dioxooxathiazolidine-3-carboxylate. InChIKey: NFAKQWFVEAEEPG-ZCFIWIBFSA-N.
| Molecular formula | C8H15NO5S |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | tert-butyl (4R)-4-methyl-2,2-dioxooxathiazolidine-3-carboxylate |
| InChIKey | NFAKQWFVEAEEPG-ZCFIWIBFSA-N |
| SMILES | C[C@@H]1COS(=O)(=O)N1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)