Products 1851857-45-8

CAS 1851857-45-8 is the registry number for 2-Hydroxy-3-(3-methyl-1,1-dioxidothiomorpholino)propanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-hydroxy-3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propanoic acid (CAS 1851857-45-8) is a chemical compound with the molecular formula C8H15NO5S and a molecular weight of 237.28 g/mol. IUPAC name: 2-hydroxy-3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propanoic acid. InChIKey: FCVDBORLKSAMKE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15NO5S
Molecular weight237.28 g/mol
IUPAC name2-hydroxy-3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propanoic acid
InChIKeyFCVDBORLKSAMKE-UHFFFAOYSA-N
SMILESCC1CS(=O)(=O)CCN1CC(C(=O)O)O

Computed by PubChem (NCBI)