CAS 454248-53-4 appears in our catalog under these names: (R)–3–Boc–4–methyl–1,2,3–oxathiazolidine 2,2–Dioxide, (R)-3-Boc-4-methyl-1,2,3-oxathiazolidine 2,2-Dioxide 98%, (R)-tert-Butyl 4-methyl-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 98%, 98%, tert-Butyl (R)-4-Methyl-2,2-dioxo-[1,2,3]oxathiazolidine-3-carboxylate, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 250mg, 1g, 10g, 500g, 50g.
Tert-butyl (4R)-4-methyl-2,2-dioxooxathiazolidine-3-carboxylate (CAS 454248-53-4) is a chemical compound with the molecular formula C8H15NO5S and a molecular weight of 237.28 g/mol. IUPAC name: tert-butyl (4R)-4-methyl-2,2-dioxooxathiazolidine-3-carboxylate. InChIKey: NFAKQWFVEAEEPG-ZCFIWIBFSA-N.
| Molecular formula | C8H15NO5S |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | tert-butyl (4R)-4-methyl-2,2-dioxooxathiazolidine-3-carboxylate |
| InChIKey | NFAKQWFVEAEEPG-ZCFIWIBFSA-N |
| SMILES | C[C@@H]1COS(=O)(=O)N1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)