CAS 1365481-13-5 appears in our catalog under these names: 5-​Methyl-1,​2,​3-​oxathiazolidine-​3-​carboxylic acid 1,​1-​dimethylethyl ester 2,​2-​dioxide, tert-Butyl 5-methyl-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide 98%, 3-Boc-5-methyl-1,2,3-oxathiazolidine 2,2-dioxide, 98%, 98%, tert-Butyl 5-methyl-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 1g, 10g, 25g, 500mg.
Tert-butyl 5-methyl-2,2-dioxooxathiazolidine-3-carboxylate (CAS 1365481-13-5) is a chemical compound with the molecular formula C8H15NO5S and a molecular weight of 237.28 g/mol. IUPAC name: tert-butyl 5-methyl-2,2-dioxooxathiazolidine-3-carboxylate. InChIKey: ZGFOJWQAHCHOLG-UHFFFAOYSA-N.
| Molecular formula | C8H15NO5S |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | tert-butyl 5-methyl-2,2-dioxooxathiazolidine-3-carboxylate |
| InChIKey | ZGFOJWQAHCHOLG-UHFFFAOYSA-N |
| SMILES | CC1CN(S(=O)(=O)O1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)